C30H31ClF7NO6S — CID 145184176
[9b-(3-chloro-4-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-hydroxycyclohexyl)methanone;formic acid (PubChem CID 145184176) has the molecular formula C30H31ClF7NO6S and a molecular weight of 702.09 g/mol. Its IUPAC name is [9b-(3-chloro-4-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-hydroxycyclohexyl)methanone;formic acid.
| Compound Name | [9b-(3-chloro-4-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-hydroxycyclohexyl)methanone;formic acid |
|---|---|
| PubChem CID | 145184176 |
| Molecular Formula | C30H31ClF7NO6S |
| Molecular Weight | 702.09 g/mol |
| Exact Mass | 701.14 |
| IUPAC Name | [9b-(3-chloro-4-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-hydroxycyclohexyl)methanone;formic acid |
| SMILES | Cc1ccc(S(=O)(=O)C23CCN(C(=O)C4(O)CCCCC4)C2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)cc1Cl.O=CO |
| InChI | InChI=1S/C29H29ClF7NO4S.CH2O2/c1-17-5-8-20(16-22(17)30)43(41,42)26-13-14-38(24(39)25(40)11-3-2-4-12-25)23(26)10-6-18-15-19(7-9-21(18)26)27(31,28(32,33)34)29(35,36)37;2-1-3/h5,7-9,15-16,23,40H,2-4,6,10-14H2,1H3;1H,(H,2,3) |
| InChIKey | XKXJGEMNDIFUQN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.09 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|