C27H34F3NO2 — CID 145184444
methyl N-[1-[4-[(4R)-6-(cycloocten-1-yl)-4-methylhexanoyl]phenyl]propa-1,2-dienyl]-2,2,2-trifluoroethanimidate (PubChem CID 145184444) has the molecular formula C27H34F3NO2 and a molecular weight of 461.57 g/mol. Its IUPAC name is methyl N-[1-[4-[(4R)-6-(cycloocten-1-yl)-4-methylhexanoyl]phenyl]propa-1,2-dienyl]-2,2,2-trifluoroethanimidate.
| Compound Name | methyl N-[1-[4-[(4R)-6-(cycloocten-1-yl)-4-methylhexanoyl]phenyl]propa-1,2-dienyl]-2,2,2-trifluoroethanimidate |
|---|---|
| PubChem CID | 145184444 |
| Molecular Formula | C27H34F3NO2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | methyl N-[1-[4-[(4R)-6-(cycloocten-1-yl)-4-methylhexanoyl]phenyl]propa-1,2-dienyl]-2,2,2-trifluoroethanimidate |
| SMILES | C=C=C(/N=C(\OC)C(F)(F)F)c1ccc(C(=O)CC[C@H](C)CCC2=CCCCCCC2)cc1 |
| InChI | InChI=1S/C27H34F3NO2/c1-4-24(31-26(33-3)27(28,29)30)22-15-17-23(18-16-22)25(32)19-13-20(2)12-14-21-10-8-6-5-7-9-11-21/h10,15-18,20H,1,5-9,11-14,19H2,2-3H3/b21-10?,31-26-/t20-/m1/s1 |
| InChIKey | JRWJYMVYZWLAND-VVLRHKKGSA-N |
| XLogP | 8.08 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|