C14H28F2N2 — CID 145185610
(4R,5S)-2-N-(2,2-dimethylpropyl)-3,3-difluoro-4,6-dimethylhept-1-ene-2,5-diamine (PubChem CID 145185610) has the molecular formula C14H28F2N2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (4R,5S)-2-N-(2,2-dimethylpropyl)-3,3-difluoro-4,6-dimethylhept-1-ene-2,5-diamine.
| Compound Name | (4R,5S)-2-N-(2,2-dimethylpropyl)-3,3-difluoro-4,6-dimethylhept-1-ene-2,5-diamine |
|---|---|
| PubChem CID | 145185610 |
| Molecular Formula | C14H28F2N2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | (4R,5S)-2-N-(2,2-dimethylpropyl)-3,3-difluoro-4,6-dimethylhept-1-ene-2,5-diamine |
| SMILES | C=C(NCC(C)(C)C)C(F)(F)[C@H](C)[C@@H](N)C(C)C |
| InChI | InChI=1S/C14H28F2N2/c1-9(2)12(17)10(3)14(15,16)11(4)18-8-13(5,6)7/h9-10,12,18H,4,8,17H2,1-3,5-7H3/t10-,12+/m1/s1 |
| InChIKey | SROMBHQIJXBFQG-PWSUYJOCSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |