C11H19F5N2 — CID 145185625
(4R,5S)-3,3-difluoro-4,6-dimethyl-2-N-(2,2,2-trifluoroethyl)hept-1-ene-2,5-diamine (PubChem CID 145185625) has the molecular formula C11H19F5N2 and a molecular weight of 274.28 g/mol. Its IUPAC name is (4R,5S)-3,3-difluoro-4,6-dimethyl-2-N-(2,2,2-trifluoroethyl)hept-1-ene-2,5-diamine.
| Compound Name | (4R,5S)-3,3-difluoro-4,6-dimethyl-2-N-(2,2,2-trifluoroethyl)hept-1-ene-2,5-diamine |
|---|---|
| PubChem CID | 145185625 |
| Molecular Formula | C11H19F5N2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (4R,5S)-3,3-difluoro-4,6-dimethyl-2-N-(2,2,2-trifluoroethyl)hept-1-ene-2,5-diamine |
| SMILES | C=C(NCC(F)(F)F)C(F)(F)[C@H](C)[C@@H](N)C(C)C |
| InChI | InChI=1S/C11H19F5N2/c1-6(2)9(17)7(3)11(15,16)8(4)18-5-10(12,13)14/h6-7,9,18H,4-5,17H2,1-3H3/t7-,9+/m1/s1 |
| InChIKey | BNSWUSPKVQJWGL-APPZFPTMSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |