C27H31N2O3+ — CID 145185763
[6-(dimethylamino)-9-[(2Z,4Z,6Z)-5-methoxycarbonylocta-2,4,6-trien-4-yl]xanthen-3-ylidene]-dimethylazanium (PubChem CID 145185763) has the molecular formula C27H31N2O3+ and a molecular weight of 431.56 g/mol. Its IUPAC name is [6-(dimethylamino)-9-[(2Z,4Z,6Z)-5-methoxycarbonylocta-2,4,6-trien-4-yl]xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [6-(dimethylamino)-9-[(2Z,4Z,6Z)-5-methoxycarbonylocta-2,4,6-trien-4-yl]xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 145185763 |
| Molecular Formula | C27H31N2O3+ |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | [6-(dimethylamino)-9-[(2Z,4Z,6Z)-5-methoxycarbonylocta-2,4,6-trien-4-yl]xanthen-3-ylidene]-dimethylazanium |
| SMILES | C/C=C\C(C(=O)OC)=C(/C=C\C)c1c2ccc(=[N+](C)C)cc-2oc2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C27H31N2O3/c1-8-10-20(21(11-9-2)27(30)31-7)26-22-14-12-18(28(3)4)16-24(22)32-25-17-19(29(5)6)13-15-23(25)26/h8-17H,1-7H3/q+1/b10-8-,11-9-,21-20- |
| InChIKey | PBZWGLNINXFALM-XLPUFPSPSA-N |
| XLogP | 4.71 |
| TPSA | 45.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|