C28H28O5 — CID 145185877
(3bR,9bS)-9b-methyl-6-[(Z)-4-phenylmethoxybut-2-enoxy]-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione (PubChem CID 145185877) has the molecular formula C28H28O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is (3bR,9bS)-9b-methyl-6-[(Z)-4-phenylmethoxybut-2-enoxy]-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione.
| Compound Name | (3bR,9bS)-9b-methyl-6-[(Z)-4-phenylmethoxybut-2-enoxy]-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione |
|---|---|
| PubChem CID | 145185877 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (3bR,9bS)-9b-methyl-6-[(Z)-4-phenylmethoxybut-2-enoxy]-3b,4,10,11-tetrahydro-3H-naphtho[2,1-e][2]benzofuran-1,5-dione |
| SMILES | C[C@]12CCC3=C(COC3=O)[C@@H]1CC(=O)c1c(OC/C=C\COCc3ccccc3)cccc12 |
| InChI | InChI=1S/C28H28O5/c1-28-13-12-20-21(18-33-27(20)30)23(28)16-24(29)26-22(28)10-7-11-25(26)32-15-6-5-14-31-17-19-8-3-2-4-9-19/h2-11,23H,12-18H2,1H3/b6-5-/t23-,28+/m0/s1 |
| InChIKey | HDNOQMNASGTNID-KVMHQPEPSA-N |
| XLogP | 4.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|