C52H23F9N4O — CID 145186317
5-(2,3,4,5,6-pentafluorophenyl)-6-[6-[5-(2,3,4,5-tetrafluorophenyl)indolo[2,3-b]indol-6-yl]dibenzofuran-2-yl]indolo[2,3-b]indole (PubChem CID 145186317) has the molecular formula C52H23F9N4O and a molecular weight of 890.77 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluorophenyl)-6-[6-[5-(2,3,4,5-tetrafluorophenyl)indolo[2,3-b]indol-6-yl]dibenzofuran-2-yl]indolo[2,3-b]indole.
| Compound Name | 5-(2,3,4,5,6-pentafluorophenyl)-6-[6-[5-(2,3,4,5-tetrafluorophenyl)indolo[2,3-b]indol-6-yl]dibenzofuran-2-yl]indolo[2,3-b]indole |
|---|---|
| PubChem CID | 145186317 |
| Molecular Formula | C52H23F9N4O |
| Molecular Weight | 890.77 g/mol |
| Exact Mass | 890.17 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluorophenyl)-6-[6-[5-(2,3,4,5-tetrafluorophenyl)indolo[2,3-b]indol-6-yl]dibenzofuran-2-yl]indolo[2,3-b]indole |
| SMILES | Fc1cc(-n2c3ccccc3c3c4ccccc4n(-c4cccc5c4oc4ccc(-n6c7ccccc7c7c8ccccc8n(-c8c(F)c(F)c(F)c(F)c8F)c76)cc45)c32)c(F)c(F)c1F |
| InChI | InChI=1S/C52H23F9N4O/c53-31-23-37(42(55)43(56)41(31)54)64-34-17-7-3-12-28(34)40-27-11-2-6-16-33(27)63(52(40)64)36-19-9-14-25-30-22-24(20-21-38(30)66-50(25)36)62-32-15-5-1-10-26(32)39-29-13-4-8-18-35(29)65(51(39)62)49-47(60)45(58)44(57)46(59)48(49)61/h1-23H |
| InChIKey | RKHMEUGWOTWOFQ-UHFFFAOYSA-N |
| XLogP | 14.92 |
| TPSA | 32.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.77 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|