C56H39N5 — CID 145186418
9-[4-[3-(2,6-diphenylpyrimidin-4-yl)-5-[2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyrimidin-4-yl]phenyl]phenyl]carbazole (PubChem CID 145186418) has the molecular formula C56H39N5 and a molecular weight of 781.96 g/mol. Its IUPAC name is 9-[4-[3-(2,6-diphenylpyrimidin-4-yl)-5-[2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyrimidin-4-yl]phenyl]phenyl]carbazole.
| Compound Name | 9-[4-[3-(2,6-diphenylpyrimidin-4-yl)-5-[2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyrimidin-4-yl]phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 145186418 |
| Molecular Formula | C56H39N5 |
| Molecular Weight | 781.96 g/mol |
| Exact Mass | 781.32 |
| IUPAC Name | 9-[4-[3-(2,6-diphenylpyrimidin-4-yl)-5-[2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylpyrimidin-4-yl]phenyl]phenyl]carbazole |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)cc(-c2cc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c2)n1 |
| InChI | InChI=1S/C56H39N5/c1-3-18-38(4-2)55-57-49(40-19-8-5-9-20-40)36-51(59-55)44-33-43(39-29-31-46(32-30-39)61-53-27-16-14-25-47(53)48-26-15-17-28-54(48)61)34-45(35-44)52-37-50(41-21-10-6-11-22-41)58-56(60-52)42-23-12-7-13-24-42/h3-37H,1-2H2/b38-18+ |
| InChIKey | BJSWKWDCWZCIPJ-CDLBOOTPSA-N |
| XLogP | 14.12 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.96 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|