C8H9BrFNO2 — CID 145186640
(2Z,3E,5E)-3-amino-6-bromo-2-(fluoromethylidene)hepta-3,5-dienoic acid (PubChem CID 145186640) has the molecular formula C8H9BrFNO2 and a molecular weight of 250.07 g/mol. Its IUPAC name is (2Z,3E,5E)-3-amino-6-bromo-2-(fluoromethylidene)hepta-3,5-dienoic acid.
| Compound Name | (2Z,3E,5E)-3-amino-6-bromo-2-(fluoromethylidene)hepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 145186640 |
| Molecular Formula | C8H9BrFNO2 |
| Molecular Weight | 250.07 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | (2Z,3E,5E)-3-amino-6-bromo-2-(fluoromethylidene)hepta-3,5-dienoic acid |
| SMILES | C/C(Br)=C\C=C(N)/C(=C/F)C(=O)O |
| InChI | InChI=1S/C8H9BrFNO2/c1-5(9)2-3-7(11)6(4-10)8(12)13/h2-4H,11H2,1H3,(H,12,13)/b5-2+,6-4-,7-3+ |
| InChIKey | YYUBCQDHFSVTBH-KWXRLIGESA-N |
| XLogP | 2.07 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.07 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|