C25H37N3O2 — CID 145186952
2-[2-(2-methoxyethoxy)ethyl]-1-methyl-4a-[2-methyl-5-(1H-pyrazol-4-yl)phenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinoline (PubChem CID 145186952) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethyl]-1-methyl-4a-[2-methyl-5-(1H-pyrazol-4-yl)phenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinoline.
| Compound Name | 2-[2-(2-methoxyethoxy)ethyl]-1-methyl-4a-[2-methyl-5-(1H-pyrazol-4-yl)phenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 145186952 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethyl]-1-methyl-4a-[2-methyl-5-(1H-pyrazol-4-yl)phenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
| SMILES | COCCOCCN1CCC2(c3cc(-c4cn[nH]c4)ccc3C)CCCCC2C1C |
| InChI | InChI=1S/C25H37N3O2/c1-19-7-8-21(22-17-26-27-18-22)16-24(19)25-9-5-4-6-23(25)20(2)28(11-10-25)12-13-30-15-14-29-3/h7-8,16-18,20,23H,4-6,9-15H2,1-3H3,(H,26,27) |
| InChIKey | DDGFPGAXZDYUHD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|