About 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine
1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine (PubChem CID 145187044) has the molecular formula C11H17FN2
and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine.
Molecular Properties
| Compound Name | 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine |
| PubChem CID | 145187044 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine |
| SMILES | FC1=CCCC=C1CN1CCNCC1 |
| InChI | InChI=1S/C11H17FN2/c12-11-4-2-1-3-10(11)9-14-7-5-13-6-8-14/h3-4,13H,1-2,5-9H2 |
| InChIKey | AGCRBSSVKNSFFE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine?
The IUPAC name of 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine (CID 145187044) is 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine.
What is the SMILES notation for 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine?
The canonical SMILES for 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine is FC1=CCCC=C1CN1CCNCC1.
What is the InChIKey of 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine?
The InChIKey is AGCRBSSVKNSFFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2/c12-11-4-2-1-3-10(11)9-14-7-5-13-6-8-14/h3-4,13H,1-2,5-9H2.
What are the key properties of 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine?
1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine has a molecular weight of 196.27 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-fluorocyclohexa-1,5-dien-1-yl)methyl]piperazine is sourced from PubChem (CID 145187044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).