C21H27F3O4S — CID 145187121
[(11S)-11-hydroxy-6,16-dimethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2,14-trienyl] trifluoromethanesulfonate (PubChem CID 145187121) has the molecular formula C21H27F3O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is [(11S)-11-hydroxy-6,16-dimethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2,14-trienyl] trifluoromethanesulfonate.
| Compound Name | [(11S)-11-hydroxy-6,16-dimethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2,14-trienyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145187121 |
| Molecular Formula | C21H27F3O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [(11S)-11-hydroxy-6,16-dimethyl-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2,14-trienyl] trifluoromethanesulfonate |
| SMILES | CC1CCC2=CC3=CCC4(C)C(OS(=O)(=O)C(F)(F)F)=CCC4[C@@]3(O)CCC2C1 |
| InChI | InChI=1S/C21H27F3O4S/c1-13-3-4-14-12-16-8-9-19(2)17(20(16,25)10-7-15(14)11-13)5-6-18(19)28-29(26,27)21(22,23)24/h6,8,12-13,15,17,25H,3-5,7,9-11H2,1-2H3/t13?,15?,17?,19?,20-/m1/s1 |
| InChIKey | XKERCEPDHIOPPH-BJCKHMSMSA-N |
| XLogP | 4.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|