C21H17BF2N2OS — CID 145187212
12-(4-ethoxyphenyl)-2,2-difluoro-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 145187212) has the molecular formula C21H17BF2N2OS and a molecular weight of 394.26 g/mol. Its IUPAC name is 12-(4-ethoxyphenyl)-2,2-difluoro-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 12-(4-ethoxyphenyl)-2,2-difluoro-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 145187212 |
| Molecular Formula | C21H17BF2N2OS |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 12-(4-ethoxyphenyl)-2,2-difluoro-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CCOc1ccc(C2=[N+]3C(=Cc4ccc(-c5cccs5)n4[B-]3(F)F)C=C2)cc1 |
| InChI | InChI=1S/C21H17BF2N2OS/c1-2-27-18-9-5-15(6-10-18)19-11-7-16-14-17-8-12-20(21-4-3-13-28-21)26(17)22(23,24)25(16)19/h3-14H,2H2,1H3 |
| InChIKey | DMBQSHXPSICGFK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|