C19H32N2 — CID 145187519
ethane;5-methyl-3,8-diazatetracyclo[7.5.0.02,7.011,13]tetradeca-1(14),2(7),3,5,9-pentaene;molecular hydrogen (PubChem CID 145187519) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is ethane;5-methyl-3,8-diazatetracyclo[7.5.0.02,7.011,13]tetradeca-1(14),2(7),3,5,9-pentaene;molecular hydrogen.
| Compound Name | ethane;5-methyl-3,8-diazatetracyclo[7.5.0.02,7.011,13]tetradeca-1(14),2(7),3,5,9-pentaene;molecular hydrogen |
|---|---|
| PubChem CID | 145187519 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | ethane;5-methyl-3,8-diazatetracyclo[7.5.0.02,7.011,13]tetradeca-1(14),2(7),3,5,9-pentaene;molecular hydrogen |
| SMILES | CC.CC.CC.Cc1cnc2c3c([nH]c2c1)=CC1CC1C=3.[H][H] |
| InChI | InChI=1S/C13H12N2.3C2H6.H2/c1-7-2-12-13(14-6-7)10-4-8-3-9(8)5-11(10)15-12;3*1-2;/h2,4-6,8-9,15H,3H2,1H3;3*1-2H3;1H |
| InChIKey | CQMXQXFKSUMZFJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |