C11H9N3O2S — CID 145187559
4-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 145187559) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 4-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 145187559 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-methylsulfonyl-3,8,12-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CS(=O)(=O)c1ccc2[nH]c3ccncc3c2n1 |
| InChI | InChI=1S/C11H9N3O2S/c1-17(15,16)10-3-2-9-11(14-10)7-6-12-5-4-8(7)13-9/h2-6,13H,1H3 |
| InChIKey | XRRCPLLKVJUZCD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |