C17H27NO — CID 145187913
ethane;9-methyl-1,2,3,4-tetrahydrocarbazol-3-ol (PubChem CID 145187913) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is ethane;9-methyl-1,2,3,4-tetrahydrocarbazol-3-ol.
| Compound Name | ethane;9-methyl-1,2,3,4-tetrahydrocarbazol-3-ol |
|---|---|
| PubChem CID | 145187913 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | ethane;9-methyl-1,2,3,4-tetrahydrocarbazol-3-ol |
| SMILES | CC.CC.Cn1c2c(c3ccccc31)CC(O)CC2 |
| InChI | InChI=1S/C13H15NO.2C2H6/c1-14-12-5-3-2-4-10(12)11-8-9(15)6-7-13(11)14;2*1-2/h2-5,9,15H,6-8H2,1H3;2*1-2H3 |
| InChIKey | CHSBFKDBJXNQAY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|