C10H20N2S — CID 145188167
ethane;5-propanimidoyl-3,6-dihydro-2H-thiopyran-4-amine (PubChem CID 145188167) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is ethane;5-propanimidoyl-3,6-dihydro-2H-thiopyran-4-amine.
| Compound Name | ethane;5-propanimidoyl-3,6-dihydro-2H-thiopyran-4-amine |
|---|---|
| PubChem CID | 145188167 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | ethane;5-propanimidoyl-3,6-dihydro-2H-thiopyran-4-amine |
| SMILES | CC.[H]/N=C(\CC)C1=C(N)CCSC1 |
| InChI | InChI=1S/C8H14N2S.C2H6/c1-2-7(9)6-5-11-4-3-8(6)10;1-2/h9H,2-5,10H2,1H3;1-2H3/b9-7+; |
| InChIKey | PWXLPTKQXFYHHP-BXTVWIJMSA-N |
| XLogP | 2.79 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|