About 1-benzofuran;1,3-benzothiazole;ethane
1-benzofuran;1,3-benzothiazole;ethane (PubChem CID 145188734) has the molecular formula C19H23NOS
and a molecular weight of 313.47 g/mol. Its IUPAC name is 1-benzofuran;1,3-benzothiazole;ethane.
Molecular Properties
| Compound Name | 1-benzofuran;1,3-benzothiazole;ethane |
| PubChem CID | 145188734 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-benzofuran;1,3-benzothiazole;ethane |
| SMILES | CC.CC.c1ccc2occc2c1.c1ccc2scnc2c1 |
| InChI | InChI=1S/C8H6O.C7H5NS.2C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-7-6(3-1)8-5-9-7;2*1-2/h1-6H;1-5H;2*1-2H3 |
| InChIKey | SDDOFEGINCOBNI-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzofuran;1,3-benzothiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;1,3-benzothiazole;ethane?
The IUPAC name of 1-benzofuran;1,3-benzothiazole;ethane (CID 145188734) is 1-benzofuran;1,3-benzothiazole;ethane.
What is the SMILES notation for 1-benzofuran;1,3-benzothiazole;ethane?
The canonical SMILES for 1-benzofuran;1,3-benzothiazole;ethane is CC.CC.c1ccc2occc2c1.c1ccc2scnc2c1.
What is the InChIKey of 1-benzofuran;1,3-benzothiazole;ethane?
The InChIKey is SDDOFEGINCOBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C7H5NS.2C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-7-6(3-1)8-5-9-7;2*1-2/h1-6H;1-5H;2*1-2H3.
What are the key properties of 1-benzofuran;1,3-benzothiazole;ethane?
1-benzofuran;1,3-benzothiazole;ethane has a molecular weight of 313.47 g/mol, XLogP of 6.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;1,3-benzothiazole;ethane is sourced from PubChem (CID 145188734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).