About [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine
[4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine (PubChem CID 145189917) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine |
| PubChem CID | 145189917 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine |
| SMILES | NCc1ccc(N2C=CCC2)cc1 |
| InChI | InChI=1S/C11H14N2/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1,3-7H,2,8-9,12H2 |
| InChIKey | SEJCADWHZPDDFU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine?
The IUPAC name of [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine (CID 145189917) is [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine.
What is the SMILES notation for [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine?
The canonical SMILES for [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine is NCc1ccc(N2C=CCC2)cc1.
What is the InChIKey of [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine?
The InChIKey is SEJCADWHZPDDFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1,3-7H,2,8-9,12H2.
What are the key properties of [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine?
[4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine has a molecular weight of 174.25 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-dihydropyrrol-1-yl)phenyl]methanamine is sourced from PubChem (CID 145189917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).