C20H26N4O5 — CID 145190462
7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-N-(2-methoxyethyl)-3-nitroquinolin-4-amine;ethane (PubChem CID 145190462) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-N-(2-methoxyethyl)-3-nitroquinolin-4-amine;ethane.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-N-(2-methoxyethyl)-3-nitroquinolin-4-amine;ethane |
|---|---|
| PubChem CID | 145190462 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-N-(2-methoxyethyl)-3-nitroquinolin-4-amine;ethane |
| SMILES | CC.COCCNc1c([N+](=O)[O-])cnc2cc(-c3c(C)noc3C)c(OC)cc12 |
| InChI | InChI=1S/C18H20N4O5.C2H6/c1-10-17(11(2)27-21-10)13-7-14-12(8-16(13)26-4)18(19-5-6-25-3)15(9-20-14)22(23)24;1-2/h7-9H,5-6H2,1-4H3,(H,19,20);1-2H3 |
| InChIKey | KOTXNVMRRXQYRZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|