C10H10F3NOS — CID 145190604
N-[(1R)-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]formamide (PubChem CID 145190604) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is N-[(1R)-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]formamide.
| Compound Name | N-[(1R)-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]formamide |
|---|---|
| PubChem CID | 145190604 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | N-[(1R)-1-[4-(trifluoromethylsulfanyl)phenyl]ethyl]formamide |
| SMILES | C[C@@H](NC=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F3NOS/c1-7(14-6-15)8-2-4-9(5-3-8)16-10(11,12)13/h2-7H,1H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | JVIYUIYAMFJQJR-SSDOTTSWSA-N |
| XLogP | 3.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|