molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine

C8H14N2 — CID 145190725

IUPACmolecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine
SMILESCCNCc1ccncc1.[H][H]
InChIInChI=1S/C8H12N2.H2/c1-2-9-7-8-3-5-10-6-4-8;/h3-6,9H,2,7H2,1H3;1H
InChIKeyWRACFTQYMNAKIW-UHFFFAOYSA-N
MW138.21 g/mol
LogP1.44
Rot. Bonds3

About molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine

molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine (PubChem CID 145190725) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine.

Molecular Properties

Compound Namemolecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine
PubChem CID145190725
Molecular FormulaC8H14N2
Molecular Weight138.21 g/mol
Exact Mass138.12
IUPAC Namemolecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine
SMILESCCNCc1ccncc1.[H][H]
InChIInChI=1S/C8H12N2.H2/c1-2-9-7-8-3-5-10-6-4-8;/h3-6,9H,2,7H2,1H3;1H
InChIKeyWRACFTQYMNAKIW-UHFFFAOYSA-N
XLogP1.44
TPSA24.92 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500138.21
LogP ≤ 51.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine?
The IUPAC name of molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine (CID 145190725) is molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine.
What is the SMILES notation for molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine?
The canonical SMILES for molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine is CCNCc1ccncc1.[H][H].
What is the InChIKey of molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine?
The InChIKey is WRACFTQYMNAKIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.H2/c1-2-9-7-8-3-5-10-6-4-8;/h3-6,9H,2,7H2,1H3;1H.
What are the key properties of molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine?
molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine has a molecular weight of 138.21 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-(pyridin-4-ylmethyl)ethanamine is sourced from PubChem (CID 145190725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).