C19H25F3N4O2 — CID 145190817
4-heptan-4-yloxy-N-(2-methoxy-5-methyl-4-pyridinyl)-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 145190817) has the molecular formula C19H25F3N4O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-heptan-4-yloxy-N-(2-methoxy-5-methyl-4-pyridinyl)-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-heptan-4-yloxy-N-(2-methoxy-5-methyl-4-pyridinyl)-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 145190817 |
| Molecular Formula | C19H25F3N4O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-heptan-4-yloxy-N-(2-methoxy-5-methyl-4-pyridinyl)-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCCC(CCC)Oc1nc(Nc2cc(OC)ncc2C)ncc1C(F)(F)F |
| InChI | InChI=1S/C19H25F3N4O2/c1-5-7-13(8-6-2)28-17-14(19(20,21)22)11-24-18(26-17)25-15-9-16(27-4)23-10-12(15)3/h9-11,13H,5-8H2,1-4H3,(H,23,24,25,26) |
| InChIKey | CNQNHVBWMVRSEF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |