C24H27N7O2S — CID 145190897
4-(2,6-dimethoxyphenyl)-N-[3-(5-methylpyrazin-2-yl)butan-2-ylsulfanyl]-5-pyridin-3-yl-1,2,4-triazol-3-amine (PubChem CID 145190897) has the molecular formula C24H27N7O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is 4-(2,6-dimethoxyphenyl)-N-[3-(5-methylpyrazin-2-yl)butan-2-ylsulfanyl]-5-pyridin-3-yl-1,2,4-triazol-3-amine.
| Compound Name | 4-(2,6-dimethoxyphenyl)-N-[3-(5-methylpyrazin-2-yl)butan-2-ylsulfanyl]-5-pyridin-3-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 145190897 |
| Molecular Formula | C24H27N7O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 4-(2,6-dimethoxyphenyl)-N-[3-(5-methylpyrazin-2-yl)butan-2-ylsulfanyl]-5-pyridin-3-yl-1,2,4-triazol-3-amine |
| SMILES | COc1cccc(OC)c1-n1c(NSC(C)C(C)c2cnc(C)cn2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C24H27N7O2S/c1-15-12-27-19(14-26-15)16(2)17(3)34-30-24-29-28-23(18-8-7-11-25-13-18)31(24)22-20(32-4)9-6-10-21(22)33-5/h6-14,16-17H,1-5H3,(H,29,30) |
| InChIKey | HYMQTEBOEJSJHD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|