C24H36O3 — CID 145191703
[(2S)-2,5,7,8-tetramethyl-2-(2-methylhexan-2-yl)-3,4-dihydrochromen-6-yl] 2-methylprop-2-enoate (PubChem CID 145191703) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(2S)-2,5,7,8-tetramethyl-2-(2-methylhexan-2-yl)-3,4-dihydrochromen-6-yl] 2-methylprop-2-enoate.
| Compound Name | [(2S)-2,5,7,8-tetramethyl-2-(2-methylhexan-2-yl)-3,4-dihydrochromen-6-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145191703 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [(2S)-2,5,7,8-tetramethyl-2-(2-methylhexan-2-yl)-3,4-dihydrochromen-6-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(C)c(C)c2c(c1C)CC[C@@](C)(C(C)(C)CCCC)O2 |
| InChI | InChI=1S/C24H36O3/c1-10-11-13-23(7,8)24(9)14-12-19-18(6)20(26-22(25)15(2)3)16(4)17(5)21(19)27-24/h2,10-14H2,1,3-9H3/t24-/m0/s1 |
| InChIKey | NVPNMOJFWZDVSA-DEOSSOPVSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|