About N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide
N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide (PubChem CID 145192215) has the molecular formula C15H14N4O
and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide |
| PubChem CID | 145192215 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NC2=c3ncccc3=CCC2)cn1 |
| InChI | InChI=1S/C15H14N4O/c1-10-8-18-13(9-17-10)15(20)19-12-6-2-4-11-5-3-7-16-14(11)12/h3-5,7-9H,2,6H2,1H3,(H,19,20) |
| InChIKey | AXIBJWUWZKMDNR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide?
The IUPAC name of N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide (CID 145192215) is N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide.
What is the SMILES notation for N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide?
The canonical SMILES for N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide is Cc1cnc(C(=O)NC2=c3ncccc3=CCC2)cn1.
What is the InChIKey of N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide?
The InChIKey is AXIBJWUWZKMDNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O/c1-10-8-18-13(9-17-10)15(20)19-12-6-2-4-11-5-3-7-16-14(11)12/h3-5,7-9H,2,6H2,1H3,(H,19,20).
What are the key properties of N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide?
N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide has a molecular weight of 266.30 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dihydroquinolin-8-yl)-5-methylpyrazine-2-carboxamide is sourced from PubChem (CID 145192215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).