C13H9F4N3 — CID 145192695
3-ethanimidoyl-6-(2,3,5,6-tetrafluorophenyl)pyridin-2-amine (PubChem CID 145192695) has the molecular formula C13H9F4N3 and a molecular weight of 283.23 g/mol. Its IUPAC name is 3-ethanimidoyl-6-(2,3,5,6-tetrafluorophenyl)pyridin-2-amine.
| Compound Name | 3-ethanimidoyl-6-(2,3,5,6-tetrafluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 145192695 |
| Molecular Formula | C13H9F4N3 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 3-ethanimidoyl-6-(2,3,5,6-tetrafluorophenyl)pyridin-2-amine |
| SMILES | [H]/N=C(\C)c1ccc(-c2c(F)c(F)cc(F)c2F)nc1N |
| InChI | InChI=1S/C13H9F4N3/c1-5(18)6-2-3-9(20-13(6)19)10-11(16)7(14)4-8(15)12(10)17/h2-4,18H,1H3,(H2,19,20)/b18-5+ |
| InChIKey | UBFHDOWMFYXNNG-BLLMUTORSA-N |
| XLogP | 3.27 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|