C25H26F2N6O — CID 145192781
N-[amino-[2-amino-6-(3,5-difluorophenyl)-3-pyridinyl]methylidene]-4-(3,3-dimethylpiperazin-1-yl)benzamide (PubChem CID 145192781) has the molecular formula C25H26F2N6O and a molecular weight of 464.52 g/mol. Its IUPAC name is N-[amino-[2-amino-6-(3,5-difluorophenyl)-3-pyridinyl]methylidene]-4-(3,3-dimethylpiperazin-1-yl)benzamide.
| Compound Name | N-[amino-[2-amino-6-(3,5-difluorophenyl)-3-pyridinyl]methylidene]-4-(3,3-dimethylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 145192781 |
| Molecular Formula | C25H26F2N6O |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[amino-[2-amino-6-(3,5-difluorophenyl)-3-pyridinyl]methylidene]-4-(3,3-dimethylpiperazin-1-yl)benzamide |
| SMILES | CC1(C)CN(c2ccc(C(=O)/N=C(\N)c3ccc(-c4cc(F)cc(F)c4)nc3N)cc2)CCN1 |
| InChI | InChI=1S/C25H26F2N6O/c1-25(2)14-33(10-9-30-25)19-5-3-15(4-6-19)24(34)32-23(29)20-7-8-21(31-22(20)28)16-11-17(26)13-18(27)12-16/h3-8,11-13,30H,9-10,14H2,1-2H3,(H2,28,31)(H2,29,32,34) |
| InChIKey | AERZIAGIVGWGEP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|