About 2-methylnaphthalene;2,2,5-trimethylhexane
2-methylnaphthalene;2,2,5-trimethylhexane (PubChem CID 145192936) has the molecular formula C20H30
and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-methylnaphthalene;2,2,5-trimethylhexane.
Molecular Properties
| Compound Name | 2-methylnaphthalene;2,2,5-trimethylhexane |
| PubChem CID | 145192936 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 2-methylnaphthalene;2,2,5-trimethylhexane |
| SMILES | CC(C)CCC(C)(C)C.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H10.C9H20/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-8(2)6-7-9(3,4)5/h2-8H,1H3;8H,6-7H2,1-5H3 |
| InChIKey | CIVITCRXEDOXDL-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylnaphthalene;2,2,5-trimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnaphthalene;2,2,5-trimethylhexane?
The IUPAC name of 2-methylnaphthalene;2,2,5-trimethylhexane (CID 145192936) is 2-methylnaphthalene;2,2,5-trimethylhexane.
What is the SMILES notation for 2-methylnaphthalene;2,2,5-trimethylhexane?
The canonical SMILES for 2-methylnaphthalene;2,2,5-trimethylhexane is CC(C)CCC(C)(C)C.Cc1ccc2ccccc2c1.
What is the InChIKey of 2-methylnaphthalene;2,2,5-trimethylhexane?
The InChIKey is CIVITCRXEDOXDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C9H20/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-8(2)6-7-9(3,4)5/h2-8H,1H3;8H,6-7H2,1-5H3.
What are the key properties of 2-methylnaphthalene;2,2,5-trimethylhexane?
2-methylnaphthalene;2,2,5-trimethylhexane has a molecular weight of 270.46 g/mol, XLogP of 6.62, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnaphthalene;2,2,5-trimethylhexane is sourced from PubChem (CID 145192936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).