About 3,6-dimethyl-1,6-dihydropyridazine;ethane
3,6-dimethyl-1,6-dihydropyridazine;ethane (PubChem CID 145193090) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 3,6-dimethyl-1,6-dihydropyridazine;ethane.
Molecular Properties
| Compound Name | 3,6-dimethyl-1,6-dihydropyridazine;ethane |
| PubChem CID | 145193090 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 3,6-dimethyl-1,6-dihydropyridazine;ethane |
| SMILES | CC.CC.CC1=NNC(C)C=C1 |
| InChI | InChI=1S/C6H10N2.2C2H6/c1-5-3-4-6(2)8-7-5;2*1-2/h3-5,7H,1-2H3;2*1-2H3 |
| InChIKey | KLDKNCCKNGLWST-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-1,6-dihydropyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1,6-dihydropyridazine;ethane?
The IUPAC name of 3,6-dimethyl-1,6-dihydropyridazine;ethane (CID 145193090) is 3,6-dimethyl-1,6-dihydropyridazine;ethane.
What is the SMILES notation for 3,6-dimethyl-1,6-dihydropyridazine;ethane?
The canonical SMILES for 3,6-dimethyl-1,6-dihydropyridazine;ethane is CC.CC.CC1=NNC(C)C=C1.
What is the InChIKey of 3,6-dimethyl-1,6-dihydropyridazine;ethane?
The InChIKey is KLDKNCCKNGLWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.2C2H6/c1-5-3-4-6(2)8-7-5;2*1-2/h3-5,7H,1-2H3;2*1-2H3.
What are the key properties of 3,6-dimethyl-1,6-dihydropyridazine;ethane?
3,6-dimethyl-1,6-dihydropyridazine;ethane has a molecular weight of 170.30 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1,6-dihydropyridazine;ethane is sourced from PubChem (CID 145193090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).