About ethane;N-propan-2-ylmethanimine;bis(prop-1-ene)
ethane;N-propan-2-ylmethanimine;bis(prop-1-ene) (PubChem CID 145193132) has the molecular formula C12H27N
and a molecular weight of 185.35 g/mol. Its IUPAC name is ethane;N-propan-2-ylmethanimine;bis(prop-1-ene).
Molecular Properties
| Compound Name | ethane;N-propan-2-ylmethanimine;bis(prop-1-ene) |
| PubChem CID | 145193132 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | ethane;N-propan-2-ylmethanimine;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.C=NC(C)C.CC |
| InChI | InChI=1S/C4H9N.2C3H6.C2H6/c1-4(2)5-3;2*1-3-2;1-2/h4H,3H2,1-2H3;2*3H,1H2,2H3;1-2H3 |
| InChIKey | XYQBZUTYBYTVBL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-propan-2-ylmethanimine;bis(prop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-propan-2-ylmethanimine;bis(prop-1-ene)?
The IUPAC name of ethane;N-propan-2-ylmethanimine;bis(prop-1-ene) (CID 145193132) is ethane;N-propan-2-ylmethanimine;bis(prop-1-ene).
What is the SMILES notation for ethane;N-propan-2-ylmethanimine;bis(prop-1-ene)?
The canonical SMILES for ethane;N-propan-2-ylmethanimine;bis(prop-1-ene) is C=CC.C=CC.C=NC(C)C.CC.
What is the InChIKey of ethane;N-propan-2-ylmethanimine;bis(prop-1-ene)?
The InChIKey is XYQBZUTYBYTVBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.2C3H6.C2H6/c1-4(2)5-3;2*1-3-2;1-2/h4H,3H2,1-2H3;2*3H,1H2,2H3;1-2H3.
What are the key properties of ethane;N-propan-2-ylmethanimine;bis(prop-1-ene)?
ethane;N-propan-2-ylmethanimine;bis(prop-1-ene) has a molecular weight of 185.35 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-propan-2-ylmethanimine;bis(prop-1-ene) is sourced from PubChem (CID 145193132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).