About (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine
(2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine (PubChem CID 145193386) has the molecular formula C18H36N2
and a molecular weight of 280.50 g/mol. Its IUPAC name is (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine.
Molecular Properties
| Compound Name | (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine |
| PubChem CID | 145193386 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine |
| SMILES | C=C.C=C(C)/C(C)=C(\C)N.CC.[H]/N=C(\C=C)C(C)CC |
| InChI | InChI=1S/2C7H13N.C2H6.C2H4/c1-5(2)6(3)7(4)8;1-4-6(3)7(8)5-2;2*1-2/h1,8H2,2-4H3;5-6,8H,2,4H2,1,3H3;1-2H3;1-2H2/b7-6+;8-7+;; |
| InChIKey | SAINQIYHULTXBN-JFPORXJESA-N |
| XLogP | 5.88 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine?
The IUPAC name of (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine (CID 145193386) is (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine.
What is the SMILES notation for (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine?
The canonical SMILES for (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine is C=C.C=C(C)/C(C)=C(\C)N.CC.[H]/N=C(\C=C)C(C)CC.
What is the InChIKey of (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine?
The InChIKey is SAINQIYHULTXBN-JFPORXJESA-N. The full InChI is InChI=1S/2C7H13N.C2H6.C2H4/c1-5(2)6(3)7(4)8;1-4-6(3)7(8)5-2;2*1-2/h1,8H2,2-4H3;5-6,8H,2,4H2,1,3H3;1-2H3;1-2H2/b7-6+;8-7+;;.
What are the key properties of (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine?
(2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine has a molecular weight of 280.50 g/mol, XLogP of 5.88, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,4-dimethylpenta-2,4-dien-2-amine;ethane;ethene;4-methylhex-1-en-3-imine is sourced from PubChem (CID 145193386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).