C32H33N3O4S — CID 145193896
4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]-N-ethylbenzenecarbothioamide (PubChem CID 145193896) has the molecular formula C32H33N3O4S and a molecular weight of 555.70 g/mol. Its IUPAC name is 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]-N-ethylbenzenecarbothioamide.
| Compound Name | 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]-N-ethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 145193896 |
| Molecular Formula | C32H33N3O4S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]-N-ethylbenzenecarbothioamide |
| SMILES | CCNC(=S)c1ccc(-n2nc(/C=C/c3ccc(OC)c(OC)c3)cc2/C=C/c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H33N3O4S/c1-6-33-32(40)24-11-15-26(16-12-24)35-27(14-8-23-10-18-29(37-3)31(20-23)39-5)21-25(34-35)13-7-22-9-17-28(36-2)30(19-22)38-4/h7-21H,6H2,1-5H3,(H,33,40)/b13-7+,14-8+ |
| InChIKey | PWRJUVOZIHJZPA-FNCQTZNRSA-N |
| XLogP | 6.53 |
| TPSA | 66.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|