About ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate
ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate (PubChem CID 145193917) has the molecular formula C32H32N2O6
and a molecular weight of 540.62 g/mol. Its IUPAC name is ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate |
| PubChem CID | 145193917 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2nc(/C=C/c3ccc(OC)c(OC)c3)cc2/C=C/c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H32N2O6/c1-6-40-32(35)24-11-15-26(16-12-24)34-27(14-8-23-10-18-29(37-3)31(20-23)39-5)21-25(33-34)13-7-22-9-17-28(36-2)30(19-22)38-4/h7-21H,6H2,1-5H3/b13-7+,14-8+ |
| InChIKey | DKZYUJPTVXUZQL-FNCQTZNRSA-N |
| XLogP | 6.42 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate?
The IUPAC name of ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate (CID 145193917) is ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate.
What is the SMILES notation for ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate?
The canonical SMILES for ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate is CCOC(=O)c1ccc(-n2nc(/C=C/c3ccc(OC)c(OC)c3)cc2/C=C/c2ccc(OC)c(OC)c2)cc1.
What is the InChIKey of ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate?
The InChIKey is DKZYUJPTVXUZQL-FNCQTZNRSA-N. The full InChI is InChI=1S/C32H32N2O6/c1-6-40-32(35)24-11-15-26(16-12-24)34-27(14-8-23-10-18-29(37-3)31(20-23)39-5)21-25(33-34)13-7-22-9-17-28(36-2)30(19-22)38-4/h7-21H,6H2,1-5H3/b13-7+,14-8+.
What are the key properties of ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate?
ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate has a molecular weight of 540.62 g/mol, XLogP of 6.42, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3,5-bis[(E)-2-(3,4-dimethoxyphenyl)ethenyl]pyrazol-1-yl]benzoate is sourced from PubChem (CID 145193917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).