C25H18F5N7O — CID 145194319
5-methyl-5-(4-methylphenyl)-6-oxo-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidine-4-carbonitrile (PubChem CID 145194319) has the molecular formula C25H18F5N7O and a molecular weight of 527.46 g/mol. Its IUPAC name is 5-methyl-5-(4-methylphenyl)-6-oxo-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidine-4-carbonitrile.
| Compound Name | 5-methyl-5-(4-methylphenyl)-6-oxo-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 145194319 |
| Molecular Formula | C25H18F5N7O |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 5-methyl-5-(4-methylphenyl)-6-oxo-2-[8-(3,3,4,4,4-pentafluorobutyl)imidazo[1,2-a]pyrazin-6-yl]-7H-pyrrolo[2,3-d]pyrimidine-4-carbonitrile |
| SMILES | Cc1ccc(C2(C)C(=O)Nc3nc(-c4cn5ccnc5c(CCC(F)(F)C(F)(F)F)n4)nc(C#N)c32)cc1 |
| InChI | InChI=1S/C25H18F5N7O/c1-13-3-5-14(6-4-13)23(2)18-16(11-31)34-19(35-20(18)36-22(23)38)17-12-37-10-9-32-21(37)15(33-17)7-8-24(26,27)25(28,29)30/h3-6,9-10,12H,7-8H2,1-2H3,(H,34,35,36,38) |
| InChIKey | FGXNXCNZNDIZGW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|