C19H27N3O — CID 145194744
N-(1-aminoethylidene)-5-tert-butyl-N'-[(E)-4-oxopent-2-en-2-yl]cyclohepta-1,4,6-triene-1-carboximidamide (PubChem CID 145194744) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is N-(1-aminoethylidene)-5-tert-butyl-N'-[(E)-4-oxopent-2-en-2-yl]cyclohepta-1,4,6-triene-1-carboximidamide.
| Compound Name | N-(1-aminoethylidene)-5-tert-butyl-N'-[(E)-4-oxopent-2-en-2-yl]cyclohepta-1,4,6-triene-1-carboximidamide |
|---|---|
| PubChem CID | 145194744 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-(1-aminoethylidene)-5-tert-butyl-N'-[(E)-4-oxopent-2-en-2-yl]cyclohepta-1,4,6-triene-1-carboximidamide |
| SMILES | CC(=O)/C=C(C)/N=C(\N=C(/C)N)C1=CCC=C(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C19H27N3O/c1-13(12-14(2)23)21-18(22-15(3)20)16-8-7-9-17(11-10-16)19(4,5)6/h8-12H,7H2,1-6H3,(H2,20,21,22)/b13-12+ |
| InChIKey | SWOLRQQFRVIAMA-OUKQBFOZSA-N |
| XLogP | 4.11 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|