C21H25N3O8 — CID 145195687
5-[(2,5-dioxopyrrolidin-1-yl)methyl]-5-[(2,5-dioxopyrrol-1-yl)methyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoic acid (PubChem CID 145195687) has the molecular formula C21H25N3O8 and a molecular weight of 447.44 g/mol. Its IUPAC name is 5-[(2,5-dioxopyrrolidin-1-yl)methyl]-5-[(2,5-dioxopyrrol-1-yl)methyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoic acid.
| Compound Name | 5-[(2,5-dioxopyrrolidin-1-yl)methyl]-5-[(2,5-dioxopyrrol-1-yl)methyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145195687 |
| Molecular Formula | C21H25N3O8 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 5-[(2,5-dioxopyrrolidin-1-yl)methyl]-5-[(2,5-dioxopyrrol-1-yl)methyl]-6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoic acid |
| SMILES | CN(CC(CCCC(=O)O)(CN1C(=O)C=CC1=O)CN1C(=O)CCC1=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C21H25N3O8/c1-22(15(26)4-3-11-25)12-21(10-2-5-20(31)32,13-23-16(27)6-7-17(23)28)14-24-18(29)8-9-19(24)30/h3-4,6-7,11H,2,5,8-10,12-14H2,1H3,(H,31,32)/b4-3- |
| InChIKey | AQVJPDNGCWIHEZ-ARJAWSKDSA-N |
| XLogP | -0.48 |
| TPSA | 149.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|