About magnesium;2-(phenoxy)oxane;bromide
magnesium;2-(phenoxy)oxane;bromide (PubChem CID 14519569) has the molecular formula C11H13BrMgO2
and a molecular weight of 281.43 g/mol. Its IUPAC name is magnesium;2-(phenoxy)oxane;bromide.
Molecular Properties
| Compound Name | magnesium;2-(phenoxy)oxane;bromide |
| PubChem CID | 14519569 |
| Molecular Formula | C11H13BrMgO2 |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | magnesium;2-(phenoxy)oxane;bromide |
| SMILES | [Br-].[Mg+2].[c-]1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C11H13O2.BrH.Mg/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;;/h2-3,6-7,11H,4-5,8-9H2;1H;/q-1;;+2/p-1 |
| InChIKey | JNWNAQZSBRFGPC-UHFFFAOYSA-M |
| XLogP | -0.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-(phenoxy)oxane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-(phenoxy)oxane;bromide?
The IUPAC name of magnesium;2-(phenoxy)oxane;bromide (CID 14519569) is magnesium;2-(phenoxy)oxane;bromide.
What is the SMILES notation for magnesium;2-(phenoxy)oxane;bromide?
The canonical SMILES for magnesium;2-(phenoxy)oxane;bromide is [Br-].[Mg+2].[c-]1ccc(OC2CCCCO2)cc1.
What is the InChIKey of magnesium;2-(phenoxy)oxane;bromide?
The InChIKey is JNWNAQZSBRFGPC-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H13O2.BrH.Mg/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;;/h2-3,6-7,11H,4-5,8-9H2;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;2-(phenoxy)oxane;bromide?
magnesium;2-(phenoxy)oxane;bromide has a molecular weight of 281.43 g/mol, XLogP of -0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-(phenoxy)oxane;bromide is sourced from PubChem (CID 14519569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).