C18H27NOU — CID 145195844
1-cyclohepta-1,3,5,6-tetraen-1-yl-2-methyliminooctan-1-one;ethane;uranium (PubChem CID 145195844) has the molecular formula C18H27NOU and a molecular weight of 511.45 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5,6-tetraen-1-yl-2-methyliminooctan-1-one;ethane;uranium.
| Compound Name | 1-cyclohepta-1,3,5,6-tetraen-1-yl-2-methyliminooctan-1-one;ethane;uranium |
|---|---|
| PubChem CID | 145195844 |
| Molecular Formula | C18H27NOU |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 1-cyclohepta-1,3,5,6-tetraen-1-yl-2-methyliminooctan-1-one;ethane;uranium |
| SMILES | CC.CCCCCC/C(=N\C)C(=O)C1=CC=CC=C=C1.[U] |
| InChI | InChI=1S/C16H21NO.C2H6.U/c1-3-4-5-10-13-15(17-2)16(18)14-11-8-6-7-9-12-14;1-2;/h6-8,11-12H,3-5,10,13H2,1-2H3;1-2H3;/b17-15+;; |
| InChIKey | BTRSTCLBCNZSNC-UVVJDXDRSA-N |
| XLogP | 4.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|