C16H21NO — CID 145195845
1-cyclohepta-1,3,5,6-tetraen-1-yl-2-methyliminooctan-1-one (PubChem CID 145195845) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5,6-tetraen-1-yl-2-methyliminooctan-1-one.
| Compound Name | 1-cyclohepta-1,3,5,6-tetraen-1-yl-2-methyliminooctan-1-one |
|---|---|
| PubChem CID | 145195845 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1-cyclohepta-1,3,5,6-tetraen-1-yl-2-methyliminooctan-1-one |
| SMILES | CCCCCC/C(=N\C)C(=O)C1=CC=CC=C=C1 |
| InChI | InChI=1S/C16H21NO/c1-3-4-5-10-13-15(17-2)16(18)14-11-8-6-7-9-12-14/h6-8,11-12H,3-5,10,13H2,1-2H3/b17-15+ |
| InChIKey | CXVAWWNRCYZKGF-BMRADRMJSA-N |
| XLogP | 3.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|