C28H39FN6 — CID 145195881
(E,3E)-1-N'-[3-[(5-fluoro-8-propan-2-yl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)methyl]-3,4-dihydropyridin-2-yl]-3-[1-(2-methylbut-3-enyl)piperidin-3-ylidene]prop-1-ene-1,1-diamine (PubChem CID 145195881) has the molecular formula C28H39FN6 and a molecular weight of 478.66 g/mol. Its IUPAC name is (E,3E)-1-N'-[3-[(5-fluoro-8-propan-2-yl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)methyl]-3,4-dihydropyridin-2-yl]-3-[1-(2-methylbut-3-enyl)piperidin-3-ylidene]prop-1-ene-1,1-diamine.
| Compound Name | (E,3E)-1-N'-[3-[(5-fluoro-8-propan-2-yl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)methyl]-3,4-dihydropyridin-2-yl]-3-[1-(2-methylbut-3-enyl)piperidin-3-ylidene]prop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 145195881 |
| Molecular Formula | C28H39FN6 |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | (E,3E)-1-N'-[3-[(5-fluoro-8-propan-2-yl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl)methyl]-3,4-dihydropyridin-2-yl]-3-[1-(2-methylbut-3-enyl)piperidin-3-ylidene]prop-1-ene-1,1-diamine |
| SMILES | C=CC(C)CN1CCC/C(=C\C=C(/N)NC2=NC=CCC2Cc2cc(F)c3[nH]n(C(C)C)c3c2)C1 |
| InChI | InChI=1S/C28H39FN6/c1-5-20(4)17-34-13-7-8-21(18-34)10-11-26(30)32-28-23(9-6-12-31-28)14-22-15-24(29)27-25(16-22)35(33-27)19(2)3/h5-6,10-12,15-16,19-20,23,33H,1,7-9,13-14,17-18,30H2,2-4H3,(H,31,32)/b21-10+,26-11+ |
| InChIKey | KHMVMRLUFRYKCJ-JGQWKSRGSA-N |
| XLogP | 5.40 |
| TPSA | 74.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|