C25H29N3 — CID 145195886
(2E)-N-(6-tert-butyl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)-2-ethenyl-1-phenylpenta-2,4-dien-1-imine (PubChem CID 145195886) has the molecular formula C25H29N3 and a molecular weight of 371.53 g/mol. Its IUPAC name is (2E)-N-(6-tert-butyl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)-2-ethenyl-1-phenylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-N-(6-tert-butyl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)-2-ethenyl-1-phenylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 145195886 |
| Molecular Formula | C25H29N3 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | (2E)-N-(6-tert-butyl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)-2-ethenyl-1-phenylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C(C=C)/C(=N\c1ccc2c(n1)CCN(C(C)(C)C)C2)c1ccccc1 |
| InChI | InChI=1S/C25H29N3/c1-6-11-19(7-2)24(20-12-9-8-10-13-20)27-23-15-14-21-18-28(25(3,4)5)17-16-22(21)26-23/h6-15H,1-2,16-18H2,3-5H3/b19-11+,27-24+ |
| InChIKey | NPYMZVHKCNOVEL-HLLMEXKNSA-N |
| XLogP | 5.66 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|