C25H36N4O — CID 145196863
butane;N-[(1E)-2-(3-cyanobenzoyl)buta-1,3-dienyl]-N'-[(1-methylpiperidin-4-yl)methyl]ethanimidamide (PubChem CID 145196863) has the molecular formula C25H36N4O and a molecular weight of 408.59 g/mol. Its IUPAC name is butane;N-[(1E)-2-(3-cyanobenzoyl)buta-1,3-dienyl]-N'-[(1-methylpiperidin-4-yl)methyl]ethanimidamide.
| Compound Name | butane;N-[(1E)-2-(3-cyanobenzoyl)buta-1,3-dienyl]-N'-[(1-methylpiperidin-4-yl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 145196863 |
| Molecular Formula | C25H36N4O |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | butane;N-[(1E)-2-(3-cyanobenzoyl)buta-1,3-dienyl]-N'-[(1-methylpiperidin-4-yl)methyl]ethanimidamide |
| SMILES | C=C/C(=C\N/C(C)=N/CC1CCN(C)CC1)C(=O)c1cccc(C#N)c1.CCCC |
| InChI | InChI=1S/C21H26N4O.C4H10/c1-4-19(21(26)20-7-5-6-18(12-20)13-22)15-24-16(2)23-14-17-8-10-25(3)11-9-17;1-3-4-2/h4-7,12,15,17H,1,8-11,14H2,2-3H3,(H,23,24);3-4H2,1-2H3/b19-15+; |
| InChIKey | XZHWJPFOBKFZSA-QTCZRQAZSA-N |
| XLogP | 4.97 |
| TPSA | 68.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|