C34H50ClN3OS — CID 145197119
acetylene;1-[4-(4-chlorophenyl)-2,6-dimethyl-1-[2-methyl-4-(propylamino)butyl]-7-(sulfanylamino)indol-5-yl]propan-2-one;2,2-dimethylpropane (PubChem CID 145197119) has the molecular formula C34H50ClN3OS and a molecular weight of 584.31 g/mol. Its IUPAC name is acetylene;1-[4-(4-chlorophenyl)-2,6-dimethyl-1-[2-methyl-4-(propylamino)butyl]-7-(sulfanylamino)indol-5-yl]propan-2-one;2,2-dimethylpropane.
| Compound Name | acetylene;1-[4-(4-chlorophenyl)-2,6-dimethyl-1-[2-methyl-4-(propylamino)butyl]-7-(sulfanylamino)indol-5-yl]propan-2-one;2,2-dimethylpropane |
|---|---|
| PubChem CID | 145197119 |
| Molecular Formula | C34H50ClN3OS |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 583.34 |
| IUPAC Name | acetylene;1-[4-(4-chlorophenyl)-2,6-dimethyl-1-[2-methyl-4-(propylamino)butyl]-7-(sulfanylamino)indol-5-yl]propan-2-one;2,2-dimethylpropane |
| SMILES | C#C.CC(C)(C)C.CCCNCCC(C)Cn1c(C)cc2c(-c3ccc(Cl)cc3)c(CC(C)=O)c(C)c(NS)c21 |
| InChI | InChI=1S/C27H36ClN3OS.C5H12.C2H2/c1-6-12-29-13-11-17(2)16-31-18(3)14-24-25(21-7-9-22(28)10-8-21)23(15-19(4)32)20(5)26(30-33)27(24)31;1-5(2,3)4;1-2/h7-10,14,17,29-30,33H,6,11-13,15-16H2,1-5H3;1-4H3;1-2H |
| InChIKey | LCPVBBYBTSSTOJ-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|