C28H36N2O3 — CID 145197241
acetylene;2-[5-(4-methoxyphenyl)-2,7,9-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetaldehyde;2-methylpropan-2-ol (PubChem CID 145197241) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is acetylene;2-[5-(4-methoxyphenyl)-2,7,9-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetaldehyde;2-methylpropan-2-ol.
| Compound Name | acetylene;2-[5-(4-methoxyphenyl)-2,7,9-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetaldehyde;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 145197241 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | acetylene;2-[5-(4-methoxyphenyl)-2,7,9-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetaldehyde;2-methylpropan-2-ol |
| SMILES | C#C.CC(C)(C)O.COc1ccc(-c2c(CC=O)c(C)c3c4c2cc(C)n4CCN3C)cc1 |
| InChI | InChI=1S/C22H24N2O2.C4H10O.C2H2/c1-14-13-19-20(16-5-7-17(26-4)8-6-16)18(9-12-25)15(2)21-22(19)24(14)11-10-23(21)3;1-4(2,3)5;1-2/h5-8,12-13H,9-11H2,1-4H3;5H,1-3H3;1-2H |
| InChIKey | RWIUCCNEKCDOCQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|