C22H24N2O — CID 145197303
3-[2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]prop-1-en-2-ol (PubChem CID 145197303) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-[2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]prop-1-en-2-ol.
| Compound Name | 3-[2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 145197303 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 3-[2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]prop-1-en-2-ol |
| SMILES | C=C(O)Cc1c(C)c2c3c(cc(C)n3CCN2)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24N2O/c1-13-5-7-17(8-6-13)20-18(12-15(3)25)16(4)21-22-19(20)11-14(2)24(22)10-9-23-21/h5-8,11,23,25H,3,9-10,12H2,1-2,4H3 |
| InChIKey | KXBVYJAKLUPIDI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|