C25H27ClN2O — CID 145197382
11-(4-chlorophenyl)-7,9,14-trimethyl-10-(2-methylprop-2-enyl)-4-oxa-1,7-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-8(15),9,11,13-tetraene (PubChem CID 145197382) has the molecular formula C25H27ClN2O and a molecular weight of 406.96 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-7,9,14-trimethyl-10-(2-methylprop-2-enyl)-4-oxa-1,7-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-8(15),9,11,13-tetraene.
| Compound Name | 11-(4-chlorophenyl)-7,9,14-trimethyl-10-(2-methylprop-2-enyl)-4-oxa-1,7-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-8(15),9,11,13-tetraene |
|---|---|
| PubChem CID | 145197382 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 11-(4-chlorophenyl)-7,9,14-trimethyl-10-(2-methylprop-2-enyl)-4-oxa-1,7-diazatetracyclo[6.6.1.02,6.012,15]pentadeca-8(15),9,11,13-tetraene |
| SMILES | C=C(C)Cc1c(C)c2c3c(cc(C)n3C3COCC3N2C)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27ClN2O/c1-14(2)10-19-16(4)24-25-20(23(19)17-6-8-18(26)9-7-17)11-15(3)28(25)22-13-29-12-21(22)27(24)5/h6-9,11,21-22H,1,10,12-13H2,2-5H3 |
| InChIKey | XBVKBYRDXHWJTJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|