C22H22F2N2O — CID 145197567
2-[5-(3,5-difluoro-4-methylphenyl)-2,7,9-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetaldehyde (PubChem CID 145197567) has the molecular formula C22H22F2N2O and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-[5-(3,5-difluoro-4-methylphenyl)-2,7,9-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetaldehyde.
| Compound Name | 2-[5-(3,5-difluoro-4-methylphenyl)-2,7,9-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 145197567 |
| Molecular Formula | C22H22F2N2O |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[5-(3,5-difluoro-4-methylphenyl)-2,7,9-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetaldehyde |
| SMILES | Cc1c(F)cc(-c2c(CC=O)c(C)c3c4c2cc(C)n4CCN3C)cc1F |
| InChI | InChI=1S/C22H22F2N2O/c1-12-9-17-20(15-10-18(23)14(3)19(24)11-15)16(5-8-27)13(2)21-22(17)26(12)7-6-25(21)4/h8-11H,5-7H2,1-4H3 |
| InChIKey | FINOKISKEJRHDW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|