C13H27N3 — CID 145197611
ethane;2-methyl-N-prop-1-en-2-ylprop-2-en-1-imine;piperazine (PubChem CID 145197611) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is ethane;2-methyl-N-prop-1-en-2-ylprop-2-en-1-imine;piperazine.
| Compound Name | ethane;2-methyl-N-prop-1-en-2-ylprop-2-en-1-imine;piperazine |
|---|---|
| PubChem CID | 145197611 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | ethane;2-methyl-N-prop-1-en-2-ylprop-2-en-1-imine;piperazine |
| SMILES | C1CNCCN1.C=C(C)/C=N/C(=C)C.CC |
| InChI | InChI=1S/C7H11N.C4H10N2.C2H6/c1-6(2)5-8-7(3)4;1-2-6-4-3-5-1;1-2/h5H,1,3H2,2,4H3;5-6H,1-4H2;1-2H3/b8-5+;; |
| InChIKey | UZEXCFYWHLZXAQ-RMZRELHQSA-N |
| XLogP | 2.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|