About N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine
N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine (PubChem CID 145197728) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine.
Molecular Properties
| Compound Name | N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine |
| PubChem CID | 145197728 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine |
| SMILES | C=C1CNC/C1=N\C(=C/C)C(C)(C)C |
| InChI | InChI=1S/C12H20N2/c1-6-11(12(3,4)5)14-10-8-13-7-9(10)2/h6,13H,2,7-8H2,1,3-5H3/b11-6-,14-10+ |
| InChIKey | UMWMCABAZCPHEX-HNPFEXMKSA-N |
| XLogP | 2.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine?
The IUPAC name of N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine (CID 145197728) is N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine.
What is the SMILES notation for N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine?
The canonical SMILES for N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine is C=C1CNC/C1=N\C(=C/C)C(C)(C)C.
What is the InChIKey of N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine?
The InChIKey is UMWMCABAZCPHEX-HNPFEXMKSA-N. The full InChI is InChI=1S/C12H20N2/c1-6-11(12(3,4)5)14-10-8-13-7-9(10)2/h6,13H,2,7-8H2,1,3-5H3/b11-6-,14-10+.
What are the key properties of N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine?
N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine has a molecular weight of 192.31 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4,4-dimethylpent-2-en-3-yl]-4-methylidenepyrrolidin-3-imine is sourced from PubChem (CID 145197728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).